About 3-methylcyclohexan-1-one;2-methylcyclopentan-1-one
3-methylcyclohexan-1-one;2-methylcyclopentan-1-one (PubChem CID 69228186) has the molecular formula C13H22O2
and a molecular weight of 210.32 g/mol. Its IUPAC name is 3-methylcyclohexan-1-one;2-methylcyclopentan-1-one.
Molecular Properties
| Compound Name | 3-methylcyclohexan-1-one;2-methylcyclopentan-1-one |
| PubChem CID | 69228186 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | 3-methylcyclohexan-1-one;2-methylcyclopentan-1-one |
| SMILES | CC1CCCC(=O)C1.CC1CCCC1=O |
| InChI | InChI=1S/C7H12O.C6H10O/c1-6-3-2-4-7(8)5-6;1-5-3-2-4-6(5)7/h6H,2-5H2,1H3;5H,2-4H2,1H3 |
| InChIKey | VKFSNHAROVUJKM-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methylcyclohexan-1-one;2-methylcyclopentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylcyclohexan-1-one;2-methylcyclopentan-1-one?
The IUPAC name of 3-methylcyclohexan-1-one;2-methylcyclopentan-1-one (CID 69228186) is 3-methylcyclohexan-1-one;2-methylcyclopentan-1-one.
What is the SMILES notation for 3-methylcyclohexan-1-one;2-methylcyclopentan-1-one?
The canonical SMILES for 3-methylcyclohexan-1-one;2-methylcyclopentan-1-one is CC1CCCC(=O)C1.CC1CCCC1=O.
What is the InChIKey of 3-methylcyclohexan-1-one;2-methylcyclopentan-1-one?
The InChIKey is VKFSNHAROVUJKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O.C6H10O/c1-6-3-2-4-7(8)5-6;1-5-3-2-4-6(5)7/h6H,2-5H2,1H3;5H,2-4H2,1H3.
What are the key properties of 3-methylcyclohexan-1-one;2-methylcyclopentan-1-one?
3-methylcyclohexan-1-one;2-methylcyclopentan-1-one has a molecular weight of 210.32 g/mol, XLogP of 3.14, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylcyclohexan-1-one;2-methylcyclopentan-1-one is sourced from PubChem (CID 69228186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).