C20H35N5O3S — CID 69228257
5-[4-amino-2-(1-methoxyethyl)-6,7-dimethylimidazo[4,5-c]pyridin-1-yl]-N-butylpentane-1-sulfonamide (PubChem CID 69228257) has the molecular formula C20H35N5O3S and a molecular weight of 425.60 g/mol. Its IUPAC name is 5-[4-amino-2-(1-methoxyethyl)-6,7-dimethylimidazo[4,5-c]pyridin-1-yl]-N-butylpentane-1-sulfonamide.
| Compound Name | 5-[4-amino-2-(1-methoxyethyl)-6,7-dimethylimidazo[4,5-c]pyridin-1-yl]-N-butylpentane-1-sulfonamide |
|---|---|
| PubChem CID | 69228257 |
| Molecular Formula | C20H35N5O3S |
| Molecular Weight | 425.60 g/mol |
| Exact Mass | 425.25 |
| IUPAC Name | 5-[4-amino-2-(1-methoxyethyl)-6,7-dimethylimidazo[4,5-c]pyridin-1-yl]-N-butylpentane-1-sulfonamide |
| SMILES | CCCCNS(=O)(=O)CCCCCn1c(C(C)OC)nc2c(N)nc(C)c(C)c21 |
| InChI | InChI=1S/C20H35N5O3S/c1-6-7-11-22-29(26,27)13-10-8-9-12-25-18-14(2)15(3)23-19(21)17(18)24-20(25)16(4)28-5/h16,22H,6-13H2,1-5H3,(H2,21,23) |
| InChIKey | KRVXGGKWWZVCEA-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.60 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|