About 2-O-benzyl 1-O-tert-butyl (4R)-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1,2-dicarboxylate
2-O-benzyl 1-O-tert-butyl (4R)-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1,2-dicarboxylate (PubChem CID 69228296) has the molecular formula C23H37NO5Si
and a molecular weight of 435.64 g/mol. Its IUPAC name is 2-O-benzyl 1-O-tert-butyl (4R)-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1,2-dicarboxylate.
Molecular Properties
| Compound Name | 2-O-benzyl 1-O-tert-butyl (4R)-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1,2-dicarboxylate |
| PubChem CID | 69228296 |
| Molecular Formula | C23H37NO5Si |
| Molecular Weight | 435.64 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | 2-O-benzyl 1-O-tert-butyl (4R)-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](O[Si](C)(C)C(C)(C)C)CC1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H37NO5Si/c1-22(2,3)28-21(26)24-15-18(29-30(7,8)23(4,5)6)14-19(24)20(25)27-16-17-12-10-9-11-13-17/h9-13,18-19H,14-16H2,1-8H3/t18-,19?/m1/s1 |
| InChIKey | BFXFQVBYYQVALC-MRTLOADZSA-N |
| XLogP | 5.13 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 435.64 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-O-benzyl 1-O-tert-butyl (4R)-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-O-benzyl 1-O-tert-butyl (4R)-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1,2-dicarboxylate?
The IUPAC name of 2-O-benzyl 1-O-tert-butyl (4R)-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1,2-dicarboxylate (CID 69228296) is 2-O-benzyl 1-O-tert-butyl (4R)-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1,2-dicarboxylate.
What is the SMILES notation for 2-O-benzyl 1-O-tert-butyl (4R)-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1,2-dicarboxylate?
The canonical SMILES for 2-O-benzyl 1-O-tert-butyl (4R)-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1,2-dicarboxylate is CC(C)(C)OC(=O)N1C[C@H](O[Si](C)(C)C(C)(C)C)CC1C(=O)OCc1ccccc1.
What is the InChIKey of 2-O-benzyl 1-O-tert-butyl (4R)-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1,2-dicarboxylate?
The InChIKey is BFXFQVBYYQVALC-MRTLOADZSA-N. The full InChI is InChI=1S/C23H37NO5Si/c1-22(2,3)28-21(26)24-15-18(29-30(7,8)23(4,5)6)14-19(24)20(25)27-16-17-12-10-9-11-13-17/h9-13,18-19H,14-16H2,1-8H3/t18-,19?/m1/s1.
What are the key properties of 2-O-benzyl 1-O-tert-butyl (4R)-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1,2-dicarboxylate?
2-O-benzyl 1-O-tert-butyl (4R)-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1,2-dicarboxylate has a molecular weight of 435.64 g/mol, XLogP of 5.13, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-O-benzyl 1-O-tert-butyl (4R)-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1,2-dicarboxylate is sourced from PubChem (CID 69228296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).