C18H22ClNO2 — CID 6922883
(5R,9R)-2-(4-chlorophenyl)-7,7,9-trimethyl-2-azaspiro[4.5]decane-1,3-dione (PubChem CID 6922883) has the molecular formula C18H22ClNO2 and a molecular weight of 319.83 g/mol. Its IUPAC name is (5R,9R)-2-(4-chlorophenyl)-7,7,9-trimethyl-2-azaspiro[4.5]decane-1,3-dione.
| Compound Name | (5R,9R)-2-(4-chlorophenyl)-7,7,9-trimethyl-2-azaspiro[4.5]decane-1,3-dione |
|---|---|
| PubChem CID | 6922883 |
| Molecular Formula | C18H22ClNO2 |
| Molecular Weight | 319.83 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | (5R,9R)-2-(4-chlorophenyl)-7,7,9-trimethyl-2-azaspiro[4.5]decane-1,3-dione |
| SMILES | C[C@@H]1CC(C)(C)C[C@@]2(CC(=O)N(c3ccc(Cl)cc3)C2=O)C1 |
| InChI | InChI=1S/C18H22ClNO2/c1-12-8-17(2,3)11-18(9-12)10-15(21)20(16(18)22)14-6-4-13(19)5-7-14/h4-7,12H,8-11H2,1-3H3/t12-,18+/m1/s1 |
| InChIKey | YWSVJDGUFNFHIX-XIKOKIGWSA-N |
| XLogP | 4.44 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.83 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|