About dimethoxymethoxy(dimethoxy)methane;1,4-dioxane
dimethoxymethoxy(dimethoxy)methane;1,4-dioxane (PubChem CID 69229879) has the molecular formula C10H22O7
and a molecular weight of 254.28 g/mol. Its IUPAC name is dimethoxymethoxy(dimethoxy)methane;1,4-dioxane.
Molecular Properties
| Compound Name | dimethoxymethoxy(dimethoxy)methane;1,4-dioxane |
| PubChem CID | 69229879 |
| Molecular Formula | C10H22O7 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | dimethoxymethoxy(dimethoxy)methane;1,4-dioxane |
| SMILES | C1COCCO1.COC(OC)OC(OC)OC |
| InChI | InChI=1S/C6H14O5.C4H8O2/c1-7-5(8-2)11-6(9-3)10-4;1-2-6-4-3-5-1/h5-6H,1-4H3;1-4H2 |
| InChIKey | DPVAMXZWYBFVOJ-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze dimethoxymethoxy(dimethoxy)methane;1,4-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethoxymethoxy(dimethoxy)methane;1,4-dioxane?
The IUPAC name of dimethoxymethoxy(dimethoxy)methane;1,4-dioxane (CID 69229879) is dimethoxymethoxy(dimethoxy)methane;1,4-dioxane.
What is the SMILES notation for dimethoxymethoxy(dimethoxy)methane;1,4-dioxane?
The canonical SMILES for dimethoxymethoxy(dimethoxy)methane;1,4-dioxane is C1COCCO1.COC(OC)OC(OC)OC.
What is the InChIKey of dimethoxymethoxy(dimethoxy)methane;1,4-dioxane?
The InChIKey is DPVAMXZWYBFVOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O5.C4H8O2/c1-7-5(8-2)11-6(9-3)10-4;1-2-6-4-3-5-1/h5-6H,1-4H3;1-4H2.
What are the key properties of dimethoxymethoxy(dimethoxy)methane;1,4-dioxane?
dimethoxymethoxy(dimethoxy)methane;1,4-dioxane has a molecular weight of 254.28 g/mol, XLogP of 0.19, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for dimethoxymethoxy(dimethoxy)methane;1,4-dioxane is sourced from PubChem (CID 69229879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).