About 4-(1,3-oxazol-5-yl)butan-2-one
4-(1,3-oxazol-5-yl)butan-2-one (PubChem CID 69229918) has the molecular formula C7H9NO2
and a molecular weight of 139.15 g/mol. Its IUPAC name is 4-(1,3-oxazol-5-yl)butan-2-one.
Molecular Properties
| Compound Name | 4-(1,3-oxazol-5-yl)butan-2-one |
| PubChem CID | 69229918 |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | 4-(1,3-oxazol-5-yl)butan-2-one |
| SMILES | CC(=O)CCc1cnco1 |
| InChI | InChI=1S/C7H9NO2/c1-6(9)2-3-7-4-8-5-10-7/h4-5H,2-3H2,1H3 |
| InChIKey | CDRAXTSMOFTPKB-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(1,3-oxazol-5-yl)butan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-oxazol-5-yl)butan-2-one?
The IUPAC name of 4-(1,3-oxazol-5-yl)butan-2-one (CID 69229918) is 4-(1,3-oxazol-5-yl)butan-2-one.
What is the SMILES notation for 4-(1,3-oxazol-5-yl)butan-2-one?
The canonical SMILES for 4-(1,3-oxazol-5-yl)butan-2-one is CC(=O)CCc1cnco1.
What is the InChIKey of 4-(1,3-oxazol-5-yl)butan-2-one?
The InChIKey is CDRAXTSMOFTPKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO2/c1-6(9)2-3-7-4-8-5-10-7/h4-5H,2-3H2,1H3.
What are the key properties of 4-(1,3-oxazol-5-yl)butan-2-one?
4-(1,3-oxazol-5-yl)butan-2-one has a molecular weight of 139.15 g/mol, XLogP of 1.20, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-oxazol-5-yl)butan-2-one is sourced from PubChem (CID 69229918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).