About 1-bromo-9,9-bis(3-methylbutyl)fluorene
1-bromo-9,9-bis(3-methylbutyl)fluorene (PubChem CID 69230197) has the molecular formula C23H29Br
and a molecular weight of 385.39 g/mol. Its IUPAC name is 1-bromo-9,9-bis(3-methylbutyl)fluorene.
Molecular Properties
| Compound Name | 1-bromo-9,9-bis(3-methylbutyl)fluorene |
| PubChem CID | 69230197 |
| Molecular Formula | C23H29Br |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 1-bromo-9,9-bis(3-methylbutyl)fluorene |
| SMILES | CC(C)CCC1(CCC(C)C)c2ccccc2-c2cccc(Br)c21 |
| InChI | InChI=1S/C23H29Br/c1-16(2)12-14-23(15-13-17(3)4)20-10-6-5-8-18(20)19-9-7-11-21(24)22(19)23/h5-11,16-17H,12-15H2,1-4H3 |
| InChIKey | RWAYJTLZQLBUEC-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-bromo-9,9-bis(3-methylbutyl)fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-9,9-bis(3-methylbutyl)fluorene?
The IUPAC name of 1-bromo-9,9-bis(3-methylbutyl)fluorene (CID 69230197) is 1-bromo-9,9-bis(3-methylbutyl)fluorene.
What is the SMILES notation for 1-bromo-9,9-bis(3-methylbutyl)fluorene?
The canonical SMILES for 1-bromo-9,9-bis(3-methylbutyl)fluorene is CC(C)CCC1(CCC(C)C)c2ccccc2-c2cccc(Br)c21.
What is the InChIKey of 1-bromo-9,9-bis(3-methylbutyl)fluorene?
The InChIKey is RWAYJTLZQLBUEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H29Br/c1-16(2)12-14-23(15-13-17(3)4)20-10-6-5-8-18(20)19-9-7-11-21(24)22(19)23/h5-11,16-17H,12-15H2,1-4H3.
What are the key properties of 1-bromo-9,9-bis(3-methylbutyl)fluorene?
1-bromo-9,9-bis(3-methylbutyl)fluorene has a molecular weight of 385.39 g/mol, XLogP of 7.59, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-9,9-bis(3-methylbutyl)fluorene is sourced from PubChem (CID 69230197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).