About (E)-3-(3-nitrophenyl)-N,N-di(propan-2-yl)prop-2-enamide
(E)-3-(3-nitrophenyl)-N,N-di(propan-2-yl)prop-2-enamide (PubChem CID 692302) has the molecular formula C15H20N2O3
and a molecular weight of 276.34 g/mol. Its IUPAC name is (E)-3-(3-nitrophenyl)-N,N-di(propan-2-yl)prop-2-enamide.
Molecular Properties
| Compound Name | (E)-3-(3-nitrophenyl)-N,N-di(propan-2-yl)prop-2-enamide |
| PubChem CID | 692302 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | (E)-3-(3-nitrophenyl)-N,N-di(propan-2-yl)prop-2-enamide |
| SMILES | CC(C)N(C(=O)/C=C/c1cccc([N+](=O)[O-])c1)C(C)C |
| InChI | InChI=1S/C15H20N2O3/c1-11(2)16(12(3)4)15(18)9-8-13-6-5-7-14(10-13)17(19)20/h5-12H,1-4H3/b9-8+ |
| InChIKey | DIVHLQIHPPWRRY-CMDGGOBGSA-N |
| XLogP | 3.25 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-(3-nitrophenyl)-N,N-di(propan-2-yl)prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-(3-nitrophenyl)-N,N-di(propan-2-yl)prop-2-enamide?
The IUPAC name of (E)-3-(3-nitrophenyl)-N,N-di(propan-2-yl)prop-2-enamide (CID 692302) is (E)-3-(3-nitrophenyl)-N,N-di(propan-2-yl)prop-2-enamide.
What is the SMILES notation for (E)-3-(3-nitrophenyl)-N,N-di(propan-2-yl)prop-2-enamide?
The canonical SMILES for (E)-3-(3-nitrophenyl)-N,N-di(propan-2-yl)prop-2-enamide is CC(C)N(C(=O)/C=C/c1cccc([N+](=O)[O-])c1)C(C)C.
What is the InChIKey of (E)-3-(3-nitrophenyl)-N,N-di(propan-2-yl)prop-2-enamide?
The InChIKey is DIVHLQIHPPWRRY-CMDGGOBGSA-N. The full InChI is InChI=1S/C15H20N2O3/c1-11(2)16(12(3)4)15(18)9-8-13-6-5-7-14(10-13)17(19)20/h5-12H,1-4H3/b9-8+.
What are the key properties of (E)-3-(3-nitrophenyl)-N,N-di(propan-2-yl)prop-2-enamide?
(E)-3-(3-nitrophenyl)-N,N-di(propan-2-yl)prop-2-enamide has a molecular weight of 276.34 g/mol, XLogP of 3.25, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(3-nitrophenyl)-N,N-di(propan-2-yl)prop-2-enamide is sourced from PubChem (CID 692302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).