2-(aminomethyl)-3-cyclohexa-2,4-dien-1-ylprop-2-enoic acid

C10H13NO2 — CID 69230336

IUPAC2-(aminomethyl)-3-cyclohexa-2,4-dien-1-ylprop-2-enoic acid
SMILESNCC(=CC1C=CC=CC1)C(=O)O
InChIInChI=1S/C10H13NO2/c11-7-9(10(12)13)6-8-4-2-1-3-5-8/h1-4,6,8H,5,7,11H2,(H,12,13)
InChIKeyFFVOVFBVTLUYPB-UHFFFAOYSA-N
MW179.22 g/mol
LogP1.09
Rot. Bonds3

About 2-(aminomethyl)-3-cyclohexa-2,4-dien-1-ylprop-2-enoic acid

2-(aminomethyl)-3-cyclohexa-2,4-dien-1-ylprop-2-enoic acid (PubChem CID 69230336) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is 2-(aminomethyl)-3-cyclohexa-2,4-dien-1-ylprop-2-enoic acid.

Molecular Properties

Compound Name2-(aminomethyl)-3-cyclohexa-2,4-dien-1-ylprop-2-enoic acid
PubChem CID69230336
Molecular FormulaC10H13NO2
Molecular Weight179.22 g/mol
Exact Mass179.09
IUPAC Name2-(aminomethyl)-3-cyclohexa-2,4-dien-1-ylprop-2-enoic acid
SMILESNCC(=CC1C=CC=CC1)C(=O)O
InChIInChI=1S/C10H13NO2/c11-7-9(10(12)13)6-8-4-2-1-3-5-8/h1-4,6,8H,5,7,11H2,(H,12,13)
InChIKeyFFVOVFBVTLUYPB-UHFFFAOYSA-N
XLogP1.09
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500179.22
LogP ≤ 51.09
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 2-(aminomethyl)-3-cyclohexa-2,4-dien-1-ylprop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(aminomethyl)-3-cyclohexa-2,4-dien-1-ylprop-2-enoic acid?
The IUPAC name of 2-(aminomethyl)-3-cyclohexa-2,4-dien-1-ylprop-2-enoic acid (CID 69230336) is 2-(aminomethyl)-3-cyclohexa-2,4-dien-1-ylprop-2-enoic acid.
What is the SMILES notation for 2-(aminomethyl)-3-cyclohexa-2,4-dien-1-ylprop-2-enoic acid?
The canonical SMILES for 2-(aminomethyl)-3-cyclohexa-2,4-dien-1-ylprop-2-enoic acid is NCC(=CC1C=CC=CC1)C(=O)O.
What is the InChIKey of 2-(aminomethyl)-3-cyclohexa-2,4-dien-1-ylprop-2-enoic acid?
The InChIKey is FFVOVFBVTLUYPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2/c11-7-9(10(12)13)6-8-4-2-1-3-5-8/h1-4,6,8H,5,7,11H2,(H,12,13).
What are the key properties of 2-(aminomethyl)-3-cyclohexa-2,4-dien-1-ylprop-2-enoic acid?
2-(aminomethyl)-3-cyclohexa-2,4-dien-1-ylprop-2-enoic acid has a molecular weight of 179.22 g/mol, XLogP of 1.09, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aminomethyl)-3-cyclohexa-2,4-dien-1-ylprop-2-enoic acid is sourced from PubChem (CID 69230336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).