C25H24FN5O4 — CID 69231088
(3R)-3-amino-4-(2-fluorophenyl)-N-[1-[(4-nitrophenyl)methyl]-2-oxo-3,4-dihydro-1,8-naphthyridin-3-yl]butanamide (PubChem CID 69231088) has the molecular formula C25H24FN5O4 and a molecular weight of 477.50 g/mol. Its IUPAC name is (3R)-3-amino-4-(2-fluorophenyl)-N-[1-[(4-nitrophenyl)methyl]-2-oxo-3,4-dihydro-1,8-naphthyridin-3-yl]butanamide.
| Compound Name | (3R)-3-amino-4-(2-fluorophenyl)-N-[1-[(4-nitrophenyl)methyl]-2-oxo-3,4-dihydro-1,8-naphthyridin-3-yl]butanamide |
|---|---|
| PubChem CID | 69231088 |
| Molecular Formula | C25H24FN5O4 |
| Molecular Weight | 477.50 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | (3R)-3-amino-4-(2-fluorophenyl)-N-[1-[(4-nitrophenyl)methyl]-2-oxo-3,4-dihydro-1,8-naphthyridin-3-yl]butanamide |
| SMILES | N[C@@H](CC(=O)NC1Cc2cccnc2N(Cc2ccc([N+](=O)[O-])cc2)C1=O)Cc1ccccc1F |
| InChI | InChI=1S/C25H24FN5O4/c26-21-6-2-1-4-17(21)12-19(27)14-23(32)29-22-13-18-5-3-11-28-24(18)30(25(22)33)15-16-7-9-20(10-8-16)31(34)35/h1-11,19,22H,12-15,27H2,(H,29,32)/t19-,22?/m1/s1 |
| InChIKey | LNWHCCSMKXTWDF-LCQOSCCDSA-N |
| XLogP | 2.66 |
| TPSA | 131.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.50 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|