About [6-[[6-(1,3-thiazol-2-yl)-2-pyridinyl]amino]-3-pyridinyl]methanol
[6-[[6-(1,3-thiazol-2-yl)-2-pyridinyl]amino]-3-pyridinyl]methanol (PubChem CID 69231355) has the molecular formula C14H12N4OS
and a molecular weight of 284.34 g/mol. Its IUPAC name is [6-[[6-(1,3-thiazol-2-yl)-2-pyridinyl]amino]-3-pyridinyl]methanol.
Molecular Properties
| Compound Name | [6-[[6-(1,3-thiazol-2-yl)-2-pyridinyl]amino]-3-pyridinyl]methanol |
| PubChem CID | 69231355 |
| Molecular Formula | C14H12N4OS |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | [6-[[6-(1,3-thiazol-2-yl)-2-pyridinyl]amino]-3-pyridinyl]methanol |
| SMILES | OCc1ccc(Nc2cccc(-c3nccs3)n2)nc1 |
| InChI | InChI=1S/C14H12N4OS/c19-9-10-4-5-12(16-8-10)18-13-3-1-2-11(17-13)14-15-6-7-20-14/h1-8,19H,9H2,(H,16,17,18) |
| InChIKey | QYWRDGUUZVYJDX-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [6-[[6-(1,3-thiazol-2-yl)-2-pyridinyl]amino]-3-pyridinyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-[[6-(1,3-thiazol-2-yl)-2-pyridinyl]amino]-3-pyridinyl]methanol?
The IUPAC name of [6-[[6-(1,3-thiazol-2-yl)-2-pyridinyl]amino]-3-pyridinyl]methanol (CID 69231355) is [6-[[6-(1,3-thiazol-2-yl)-2-pyridinyl]amino]-3-pyridinyl]methanol.
What is the SMILES notation for [6-[[6-(1,3-thiazol-2-yl)-2-pyridinyl]amino]-3-pyridinyl]methanol?
The canonical SMILES for [6-[[6-(1,3-thiazol-2-yl)-2-pyridinyl]amino]-3-pyridinyl]methanol is OCc1ccc(Nc2cccc(-c3nccs3)n2)nc1.
What is the InChIKey of [6-[[6-(1,3-thiazol-2-yl)-2-pyridinyl]amino]-3-pyridinyl]methanol?
The InChIKey is QYWRDGUUZVYJDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N4OS/c19-9-10-4-5-12(16-8-10)18-13-3-1-2-11(17-13)14-15-6-7-20-14/h1-8,19H,9H2,(H,16,17,18).
What are the key properties of [6-[[6-(1,3-thiazol-2-yl)-2-pyridinyl]amino]-3-pyridinyl]methanol?
[6-[[6-(1,3-thiazol-2-yl)-2-pyridinyl]amino]-3-pyridinyl]methanol has a molecular weight of 284.34 g/mol, XLogP of 2.84, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [6-[[6-(1,3-thiazol-2-yl)-2-pyridinyl]amino]-3-pyridinyl]methanol is sourced from PubChem (CID 69231355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).