About 1-ethyl-9H-carbazole-2,7-diamine
1-ethyl-9H-carbazole-2,7-diamine (PubChem CID 69231599) has the molecular formula C14H15N3
and a molecular weight of 225.29 g/mol. Its IUPAC name is 1-ethyl-9H-carbazole-2,7-diamine.
Molecular Properties
| Compound Name | 1-ethyl-9H-carbazole-2,7-diamine |
| PubChem CID | 69231599 |
| Molecular Formula | C14H15N3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 1-ethyl-9H-carbazole-2,7-diamine |
| SMILES | CCc1c(N)ccc2c1[nH]c1cc(N)ccc12 |
| InChI | InChI=1S/C14H15N3/c1-2-9-12(16)6-5-11-10-4-3-8(15)7-13(10)17-14(9)11/h3-7,17H,2,15-16H2,1H3 |
| InChIKey | JYKSJCAPYDLZDE-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 67.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-9H-carbazole-2,7-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-9H-carbazole-2,7-diamine?
The IUPAC name of 1-ethyl-9H-carbazole-2,7-diamine (CID 69231599) is 1-ethyl-9H-carbazole-2,7-diamine.
What is the SMILES notation for 1-ethyl-9H-carbazole-2,7-diamine?
The canonical SMILES for 1-ethyl-9H-carbazole-2,7-diamine is CCc1c(N)ccc2c1[nH]c1cc(N)ccc12.
What is the InChIKey of 1-ethyl-9H-carbazole-2,7-diamine?
The InChIKey is JYKSJCAPYDLZDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3/c1-2-9-12(16)6-5-11-10-4-3-8(15)7-13(10)17-14(9)11/h3-7,17H,2,15-16H2,1H3.
What are the key properties of 1-ethyl-9H-carbazole-2,7-diamine?
1-ethyl-9H-carbazole-2,7-diamine has a molecular weight of 225.29 g/mol, XLogP of 3.05, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-9H-carbazole-2,7-diamine is sourced from PubChem (CID 69231599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).