About 3-amino-1-ethyl-3,4-dihydro-1,8-naphthyridin-2-one;dihydrochloride
3-amino-1-ethyl-3,4-dihydro-1,8-naphthyridin-2-one;dihydrochloride (PubChem CID 69232619) has the molecular formula C10H15Cl2N3O
and a molecular weight of 264.16 g/mol. Its IUPAC name is 3-amino-1-ethyl-3,4-dihydro-1,8-naphthyridin-2-one;dihydrochloride.
Molecular Properties
| Compound Name | 3-amino-1-ethyl-3,4-dihydro-1,8-naphthyridin-2-one;dihydrochloride |
| PubChem CID | 69232619 |
| Molecular Formula | C10H15Cl2N3O |
| Molecular Weight | 264.16 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 3-amino-1-ethyl-3,4-dihydro-1,8-naphthyridin-2-one;dihydrochloride |
| SMILES | CCN1C(=O)C(N)Cc2cccnc21.Cl.Cl |
| InChI | InChI=1S/C10H13N3O.2ClH/c1-2-13-9-7(4-3-5-12-9)6-8(11)10(13)14;;/h3-5,8H,2,6,11H2,1H3;2*1H |
| InChIKey | PMYFPWHCXUDLNM-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.16 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-amino-1-ethyl-3,4-dihydro-1,8-naphthyridin-2-one;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1-ethyl-3,4-dihydro-1,8-naphthyridin-2-one;dihydrochloride?
The IUPAC name of 3-amino-1-ethyl-3,4-dihydro-1,8-naphthyridin-2-one;dihydrochloride (CID 69232619) is 3-amino-1-ethyl-3,4-dihydro-1,8-naphthyridin-2-one;dihydrochloride.
What is the SMILES notation for 3-amino-1-ethyl-3,4-dihydro-1,8-naphthyridin-2-one;dihydrochloride?
The canonical SMILES for 3-amino-1-ethyl-3,4-dihydro-1,8-naphthyridin-2-one;dihydrochloride is CCN1C(=O)C(N)Cc2cccnc21.Cl.Cl.
What is the InChIKey of 3-amino-1-ethyl-3,4-dihydro-1,8-naphthyridin-2-one;dihydrochloride?
The InChIKey is PMYFPWHCXUDLNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O.2ClH/c1-2-13-9-7(4-3-5-12-9)6-8(11)10(13)14;;/h3-5,8H,2,6,11H2,1H3;2*1H.
What are the key properties of 3-amino-1-ethyl-3,4-dihydro-1,8-naphthyridin-2-one;dihydrochloride?
3-amino-1-ethyl-3,4-dihydro-1,8-naphthyridin-2-one;dihydrochloride has a molecular weight of 264.16 g/mol, XLogP of 1.16, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1-ethyl-3,4-dihydro-1,8-naphthyridin-2-one;dihydrochloride is sourced from PubChem (CID 69232619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).