About 1-chloro-1,2-difluorocyclopropane
1-chloro-1,2-difluorocyclopropane (PubChem CID 69232639) has the molecular formula C3H3ClF2
and a molecular weight of 112.51 g/mol. Its IUPAC name is 1-chloro-1,2-difluorocyclopropane.
Molecular Properties
| Compound Name | 1-chloro-1,2-difluorocyclopropane |
| PubChem CID | 69232639 |
| Molecular Formula | C3H3ClF2 |
| Molecular Weight | 112.51 g/mol |
| Exact Mass | 111.99 |
| IUPAC Name | 1-chloro-1,2-difluorocyclopropane |
| SMILES | FC1CC1(F)Cl |
| InChI | InChI=1S/C3H3ClF2/c4-3(6)1-2(3)5/h2H,1H2 |
| InChIKey | FUUWRHUTCRXJPN-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.51 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-1,2-difluorocyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-1,2-difluorocyclopropane?
The IUPAC name of 1-chloro-1,2-difluorocyclopropane (CID 69232639) is 1-chloro-1,2-difluorocyclopropane.
What is the SMILES notation for 1-chloro-1,2-difluorocyclopropane?
The canonical SMILES for 1-chloro-1,2-difluorocyclopropane is FC1CC1(F)Cl.
What is the InChIKey of 1-chloro-1,2-difluorocyclopropane?
The InChIKey is FUUWRHUTCRXJPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H3ClF2/c4-3(6)1-2(3)5/h2H,1H2.
What are the key properties of 1-chloro-1,2-difluorocyclopropane?
1-chloro-1,2-difluorocyclopropane has a molecular weight of 112.51 g/mol, XLogP of 1.63, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-1,2-difluorocyclopropane is sourced from PubChem (CID 69232639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).