C13H17Cl3O3 — CID 6923273
3-hydroxy-5,5-dimethyl-2-[(3S)-1,1,1-trichloro-4-oxopentan-3-yl]cyclohex-2-en-1-one (PubChem CID 6923273) has the molecular formula C13H17Cl3O3 and a molecular weight of 327.64 g/mol. Its IUPAC name is 3-hydroxy-5,5-dimethyl-2-[(3S)-1,1,1-trichloro-4-oxopentan-3-yl]cyclohex-2-en-1-one.
| Compound Name | 3-hydroxy-5,5-dimethyl-2-[(3S)-1,1,1-trichloro-4-oxopentan-3-yl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 6923273 |
| Molecular Formula | C13H17Cl3O3 |
| Molecular Weight | 327.64 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | 3-hydroxy-5,5-dimethyl-2-[(3S)-1,1,1-trichloro-4-oxopentan-3-yl]cyclohex-2-en-1-one |
| SMILES | CC(=O)[C@@H](CC(Cl)(Cl)Cl)C1=C(O)CC(C)(C)CC1=O |
| InChI | InChI=1S/C13H17Cl3O3/c1-7(17)8(4-13(14,15)16)11-9(18)5-12(2,3)6-10(11)19/h8,18H,4-6H2,1-3H3/t8-/m1/s1 |
| InChIKey | IEPDAORYYMWBDS-MRVPVSSYSA-N |
| XLogP | 4.15 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.64 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|