C25H33N5O4 — CID 69232979
(2S)-2-amino-N-[(2S,3R)-5-[2-(5-aminopentylamino)-2-oxoethyl]-4-oxo-2-phenyl-2,3-dihydro-1,5-benzoxazepin-3-yl]propanamide (PubChem CID 69232979) has the molecular formula C25H33N5O4 and a molecular weight of 467.57 g/mol. Its IUPAC name is (2S)-2-amino-N-[(2S,3R)-5-[2-(5-aminopentylamino)-2-oxoethyl]-4-oxo-2-phenyl-2,3-dihydro-1,5-benzoxazepin-3-yl]propanamide.
| Compound Name | (2S)-2-amino-N-[(2S,3R)-5-[2-(5-aminopentylamino)-2-oxoethyl]-4-oxo-2-phenyl-2,3-dihydro-1,5-benzoxazepin-3-yl]propanamide |
|---|---|
| PubChem CID | 69232979 |
| Molecular Formula | C25H33N5O4 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | (2S)-2-amino-N-[(2S,3R)-5-[2-(5-aminopentylamino)-2-oxoethyl]-4-oxo-2-phenyl-2,3-dihydro-1,5-benzoxazepin-3-yl]propanamide |
| SMILES | C[C@H](N)C(=O)N[C@H]1C(=O)N(CC(=O)NCCCCCN)c2ccccc2O[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C25H33N5O4/c1-17(27)24(32)29-22-23(18-10-4-2-5-11-18)34-20-13-7-6-12-19(20)30(25(22)33)16-21(31)28-15-9-3-8-14-26/h2,4-7,10-13,17,22-23H,3,8-9,14-16,26-27H2,1H3,(H,28,31)(H,29,32)/t17-,22+,23+/m0/s1 |
| InChIKey | IBTWBYLUVCQQAQ-JJEOQYAHSA-N |
| XLogP | 1.23 |
| TPSA | 139.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|