About dimethyl (4R)-4-(3-hydroxy-4-methoxyphenyl)-3,4-dihydropyridine-3,5-dicarboxylate
dimethyl (4R)-4-(3-hydroxy-4-methoxyphenyl)-3,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 6923313) has the molecular formula C16H17NO6
and a molecular weight of 319.31 g/mol. Its IUPAC name is dimethyl (4R)-4-(3-hydroxy-4-methoxyphenyl)-3,4-dihydropyridine-3,5-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl (4R)-4-(3-hydroxy-4-methoxyphenyl)-3,4-dihydropyridine-3,5-dicarboxylate |
| PubChem CID | 6923313 |
| Molecular Formula | C16H17NO6 |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | dimethyl (4R)-4-(3-hydroxy-4-methoxyphenyl)-3,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=CN=CC(C(=O)OC)[C@@H]1c1ccc(OC)c(O)c1 |
| InChI | InChI=1S/C16H17NO6/c1-21-13-5-4-9(6-12(13)18)14-10(15(19)22-2)7-17-8-11(14)16(20)23-3/h4-8,10,14,18H,1-3H3/t10?,14-/m0/s1 |
| InChIKey | QIRCJHDVIALGCH-SBNLOKMTSA-N |
| XLogP | 1.41 |
| TPSA | 94.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze dimethyl (4R)-4-(3-hydroxy-4-methoxyphenyl)-3,4-dihydropyridine-3,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl (4R)-4-(3-hydroxy-4-methoxyphenyl)-3,4-dihydropyridine-3,5-dicarboxylate?
The IUPAC name of dimethyl (4R)-4-(3-hydroxy-4-methoxyphenyl)-3,4-dihydropyridine-3,5-dicarboxylate (CID 6923313) is dimethyl (4R)-4-(3-hydroxy-4-methoxyphenyl)-3,4-dihydropyridine-3,5-dicarboxylate.
What is the SMILES notation for dimethyl (4R)-4-(3-hydroxy-4-methoxyphenyl)-3,4-dihydropyridine-3,5-dicarboxylate?
The canonical SMILES for dimethyl (4R)-4-(3-hydroxy-4-methoxyphenyl)-3,4-dihydropyridine-3,5-dicarboxylate is COC(=O)C1=CN=CC(C(=O)OC)[C@@H]1c1ccc(OC)c(O)c1.
What is the InChIKey of dimethyl (4R)-4-(3-hydroxy-4-methoxyphenyl)-3,4-dihydropyridine-3,5-dicarboxylate?
The InChIKey is QIRCJHDVIALGCH-SBNLOKMTSA-N. The full InChI is InChI=1S/C16H17NO6/c1-21-13-5-4-9(6-12(13)18)14-10(15(19)22-2)7-17-8-11(14)16(20)23-3/h4-8,10,14,18H,1-3H3/t10?,14-/m0/s1.
What are the key properties of dimethyl (4R)-4-(3-hydroxy-4-methoxyphenyl)-3,4-dihydropyridine-3,5-dicarboxylate?
dimethyl (4R)-4-(3-hydroxy-4-methoxyphenyl)-3,4-dihydropyridine-3,5-dicarboxylate has a molecular weight of 319.31 g/mol, XLogP of 1.41, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl (4R)-4-(3-hydroxy-4-methoxyphenyl)-3,4-dihydropyridine-3,5-dicarboxylate is sourced from PubChem (CID 6923313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).