C9H12N4O3 — CID 69233160
1-amino-3-(furo[2,3-d]pyrimidin-2-ylamino)propane-1,3-diol (PubChem CID 69233160) has the molecular formula C9H12N4O3 and a molecular weight of 224.22 g/mol. Its IUPAC name is 1-amino-3-(furo[2,3-d]pyrimidin-2-ylamino)propane-1,3-diol.
| Compound Name | 1-amino-3-(furo[2,3-d]pyrimidin-2-ylamino)propane-1,3-diol |
|---|---|
| PubChem CID | 69233160 |
| Molecular Formula | C9H12N4O3 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 1-amino-3-(furo[2,3-d]pyrimidin-2-ylamino)propane-1,3-diol |
| SMILES | NC(O)CC(O)Nc1ncc2ccoc2n1 |
| InChI | InChI=1S/C9H12N4O3/c10-6(14)3-7(15)12-9-11-4-5-1-2-16-8(5)13-9/h1-2,4,6-7,14-15H,3,10H2,(H,11,12,13) |
| InChIKey | ZWRFPZPAYXCKAC-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 117.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|