C12H16N3O2+ — CID 6923317
[(2R)-4-(1H-benzimidazol-2-yl)-1-methoxy-1-oxobutan-2-yl]azanium (PubChem CID 6923317) has the molecular formula C12H16N3O2+ and a molecular weight of 234.28 g/mol. Its IUPAC name is [(2R)-4-(1H-benzimidazol-2-yl)-1-methoxy-1-oxobutan-2-yl]azanium.
| Compound Name | [(2R)-4-(1H-benzimidazol-2-yl)-1-methoxy-1-oxobutan-2-yl]azanium |
|---|---|
| PubChem CID | 6923317 |
| Molecular Formula | C12H16N3O2+ |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | [(2R)-4-(1H-benzimidazol-2-yl)-1-methoxy-1-oxobutan-2-yl]azanium |
| SMILES | COC(=O)[C@H]([NH3+])CCc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C12H15N3O2/c1-17-12(16)8(13)6-7-11-14-9-4-2-3-5-10(9)15-11/h2-5,8H,6-7,13H2,1H3,(H,14,15)/p+1/t8-/m1/s1 |
| InChIKey | BZVSBRDPXVEJDU-MRVPVSSYSA-O |
| XLogP | 0.28 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |