About CID 69233361
CID 69233361 (PubChem CID 69233361) has the molecular formula C19H39O3Si2
and a molecular weight of 371.69 g/mol.
Molecular Properties
| Compound Name | CID 69233361 |
| PubChem CID | 69233361 |
| Molecular Formula | C19H39O3Si2 |
| Molecular Weight | 371.69 g/mol |
| Exact Mass | 371.24 |
| IUPAC Name | — |
| SMILES | C[Si](C)OC([C@@H]1C=C[C@H](O)C[C@@H]1O[Si](C)(C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C19H39O3Si2/c1-18(2,3)17(21-23(7)8)15-12-11-14(20)13-16(15)22-24(9,10)19(4,5)6/h11-12,14-17,20H,13H2,1-10H3/t14-,15+,16-,17?/m0/s1 |
| InChIKey | IMKCIXAJKAWYMS-TVXGVJEUSA-N |
| XLogP | 5.00 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.69 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 69233361 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 69233361?
The IUPAC name of CID 69233361 (CID 69233361) is not available.
What is the SMILES notation for CID 69233361?
The canonical SMILES for CID 69233361 is C[Si](C)OC([C@@H]1C=C[C@H](O)C[C@@H]1O[Si](C)(C)C(C)(C)C)C(C)(C)C.
What is the InChIKey of CID 69233361?
The InChIKey is IMKCIXAJKAWYMS-TVXGVJEUSA-N. The full InChI is InChI=1S/C19H39O3Si2/c1-18(2,3)17(21-23(7)8)15-12-11-14(20)13-16(15)22-24(9,10)19(4,5)6/h11-12,14-17,20H,13H2,1-10H3/t14-,15+,16-,17?/m0/s1.
What are the key properties of CID 69233361?
CID 69233361 has a molecular weight of 371.69 g/mol, XLogP of 5.00, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 69233361 is sourced from PubChem (CID 69233361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).