About 7-(3,4-dichlorophenyl)-7,9-diazabicyclo[4.2.2]dec-3-ene
7-(3,4-dichlorophenyl)-7,9-diazabicyclo[4.2.2]dec-3-ene (PubChem CID 69233405) has the molecular formula C14H16Cl2N2
and a molecular weight of 283.20 g/mol. Its IUPAC name is 7-(3,4-dichlorophenyl)-7,9-diazabicyclo[4.2.2]dec-3-ene.
Molecular Properties
| Compound Name | 7-(3,4-dichlorophenyl)-7,9-diazabicyclo[4.2.2]dec-3-ene |
| PubChem CID | 69233405 |
| Molecular Formula | C14H16Cl2N2 |
| Molecular Weight | 283.20 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 7-(3,4-dichlorophenyl)-7,9-diazabicyclo[4.2.2]dec-3-ene |
| SMILES | Clc1ccc(N2CC3CC=CCC2CN3)cc1Cl |
| InChI | InChI=1S/C14H16Cl2N2/c15-13-6-5-11(7-14(13)16)18-9-10-3-1-2-4-12(18)8-17-10/h1-2,5-7,10,12,17H,3-4,8-9H2 |
| InChIKey | OEJDTRLOYBUVBD-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.20 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-(3,4-dichlorophenyl)-7,9-diazabicyclo[4.2.2]dec-3-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(3,4-dichlorophenyl)-7,9-diazabicyclo[4.2.2]dec-3-ene?
The IUPAC name of 7-(3,4-dichlorophenyl)-7,9-diazabicyclo[4.2.2]dec-3-ene (CID 69233405) is 7-(3,4-dichlorophenyl)-7,9-diazabicyclo[4.2.2]dec-3-ene.
What is the SMILES notation for 7-(3,4-dichlorophenyl)-7,9-diazabicyclo[4.2.2]dec-3-ene?
The canonical SMILES for 7-(3,4-dichlorophenyl)-7,9-diazabicyclo[4.2.2]dec-3-ene is Clc1ccc(N2CC3CC=CCC2CN3)cc1Cl.
What is the InChIKey of 7-(3,4-dichlorophenyl)-7,9-diazabicyclo[4.2.2]dec-3-ene?
The InChIKey is OEJDTRLOYBUVBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16Cl2N2/c15-13-6-5-11(7-14(13)16)18-9-10-3-1-2-4-12(18)8-17-10/h1-2,5-7,10,12,17H,3-4,8-9H2.
What are the key properties of 7-(3,4-dichlorophenyl)-7,9-diazabicyclo[4.2.2]dec-3-ene?
7-(3,4-dichlorophenyl)-7,9-diazabicyclo[4.2.2]dec-3-ene has a molecular weight of 283.20 g/mol, XLogP of 3.49, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(3,4-dichlorophenyl)-7,9-diazabicyclo[4.2.2]dec-3-ene is sourced from PubChem (CID 69233405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).