C29H20F3N5O2S — CID 69233526
2-[(2S)-2-[(5-isoquinolin-6-yl-1,3,4-thiadiazol-2-yl)amino]-3-[3-(trifluoromethyl)phenyl]propyl]isoindole-1,3-dione (PubChem CID 69233526) has the molecular formula C29H20F3N5O2S and a molecular weight of 559.57 g/mol. Its IUPAC name is 2-[(2S)-2-[(5-isoquinolin-6-yl-1,3,4-thiadiazol-2-yl)amino]-3-[3-(trifluoromethyl)phenyl]propyl]isoindole-1,3-dione.
| Compound Name | 2-[(2S)-2-[(5-isoquinolin-6-yl-1,3,4-thiadiazol-2-yl)amino]-3-[3-(trifluoromethyl)phenyl]propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 69233526 |
| Molecular Formula | C29H20F3N5O2S |
| Molecular Weight | 559.57 g/mol |
| Exact Mass | 559.13 |
| IUPAC Name | 2-[(2S)-2-[(5-isoquinolin-6-yl-1,3,4-thiadiazol-2-yl)amino]-3-[3-(trifluoromethyl)phenyl]propyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1C[C@H](Cc1cccc(C(F)(F)F)c1)Nc1nnc(-c2ccc3cnccc3c2)s1 |
| InChI | InChI=1S/C29H20F3N5O2S/c30-29(31,32)21-5-3-4-17(12-21)13-22(16-37-26(38)23-6-1-2-7-24(23)27(37)39)34-28-36-35-25(40-28)19-8-9-20-15-33-11-10-18(20)14-19/h1-12,14-15,22H,13,16H2,(H,34,36)/t22-/m0/s1 |
| InChIKey | YQONLXLYXWFHGK-QFIPXVFZSA-N |
| XLogP | 6.09 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.57 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|