C13H13N5S — CID 69233553
5-(8-propyl-1,6-naphthyridin-2-yl)-1,3,4-thiadiazol-2-amine (PubChem CID 69233553) has the molecular formula C13H13N5S and a molecular weight of 271.35 g/mol. Its IUPAC name is 5-(8-propyl-1,6-naphthyridin-2-yl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-(8-propyl-1,6-naphthyridin-2-yl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 69233553 |
| Molecular Formula | C13H13N5S |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 5-(8-propyl-1,6-naphthyridin-2-yl)-1,3,4-thiadiazol-2-amine |
| SMILES | CCCc1cncc2ccc(-c3nnc(N)s3)nc12 |
| InChI | InChI=1S/C13H13N5S/c1-2-3-8-6-15-7-9-4-5-10(16-11(8)9)12-17-18-13(14)19-12/h4-7H,2-3H2,1H3,(H2,14,18) |
| InChIKey | DCRBGAPRFDHNCD-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 77.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |