About 3-[3-methoxy-6-(1,3-thiazol-2-yl)-2-pyridinyl]-5-(4-methylpiperazin-1-yl)pyridin-2-amine
3-[3-methoxy-6-(1,3-thiazol-2-yl)-2-pyridinyl]-5-(4-methylpiperazin-1-yl)pyridin-2-amine (PubChem CID 69233782) has the molecular formula C19H22N6OS
and a molecular weight of 382.49 g/mol. Its IUPAC name is 3-[3-methoxy-6-(1,3-thiazol-2-yl)-2-pyridinyl]-5-(4-methylpiperazin-1-yl)pyridin-2-amine.
Molecular Properties
| Compound Name | 3-[3-methoxy-6-(1,3-thiazol-2-yl)-2-pyridinyl]-5-(4-methylpiperazin-1-yl)pyridin-2-amine |
| PubChem CID | 69233782 |
| Molecular Formula | C19H22N6OS |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 3-[3-methoxy-6-(1,3-thiazol-2-yl)-2-pyridinyl]-5-(4-methylpiperazin-1-yl)pyridin-2-amine |
| SMILES | COc1ccc(-c2nccs2)nc1-c1cc(N2CCN(C)CC2)cnc1N |
| InChI | InChI=1S/C19H22N6OS/c1-24-6-8-25(9-7-24)13-11-14(18(20)22-12-13)17-16(26-2)4-3-15(23-17)19-21-5-10-27-19/h3-5,10-12H,6-9H2,1-2H3,(H2,20,22) |
| InChIKey | YTYBBQBHJPALFU-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 3-[3-methoxy-6-(1,3-thiazol-2-yl)-2-pyridinyl]-5-(4-methylpiperazin-1-yl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-methoxy-6-(1,3-thiazol-2-yl)-2-pyridinyl]-5-(4-methylpiperazin-1-yl)pyridin-2-amine?
The IUPAC name of 3-[3-methoxy-6-(1,3-thiazol-2-yl)-2-pyridinyl]-5-(4-methylpiperazin-1-yl)pyridin-2-amine (CID 69233782) is 3-[3-methoxy-6-(1,3-thiazol-2-yl)-2-pyridinyl]-5-(4-methylpiperazin-1-yl)pyridin-2-amine.
What is the SMILES notation for 3-[3-methoxy-6-(1,3-thiazol-2-yl)-2-pyridinyl]-5-(4-methylpiperazin-1-yl)pyridin-2-amine?
The canonical SMILES for 3-[3-methoxy-6-(1,3-thiazol-2-yl)-2-pyridinyl]-5-(4-methylpiperazin-1-yl)pyridin-2-amine is COc1ccc(-c2nccs2)nc1-c1cc(N2CCN(C)CC2)cnc1N.
What is the InChIKey of 3-[3-methoxy-6-(1,3-thiazol-2-yl)-2-pyridinyl]-5-(4-methylpiperazin-1-yl)pyridin-2-amine?
The InChIKey is YTYBBQBHJPALFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N6OS/c1-24-6-8-25(9-7-24)13-11-14(18(20)22-12-13)17-16(26-2)4-3-15(23-17)19-21-5-10-27-19/h3-5,10-12H,6-9H2,1-2H3,(H2,20,22).
What are the key properties of 3-[3-methoxy-6-(1,3-thiazol-2-yl)-2-pyridinyl]-5-(4-methylpiperazin-1-yl)pyridin-2-amine?
3-[3-methoxy-6-(1,3-thiazol-2-yl)-2-pyridinyl]-5-(4-methylpiperazin-1-yl)pyridin-2-amine has a molecular weight of 382.49 g/mol, XLogP of 2.61, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-methoxy-6-(1,3-thiazol-2-yl)-2-pyridinyl]-5-(4-methylpiperazin-1-yl)pyridin-2-amine is sourced from PubChem (CID 69233782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).