C10H19N2O+ — CID 69233860
1-(2,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrimidin-5-ium-5-yl)propan-2-ol (PubChem CID 69233860) has the molecular formula C10H19N2O+ and a molecular weight of 183.27 g/mol. Its IUPAC name is 1-(2,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrimidin-5-ium-5-yl)propan-2-ol.
| Compound Name | 1-(2,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrimidin-5-ium-5-yl)propan-2-ol |
|---|---|
| PubChem CID | 69233860 |
| Molecular Formula | C10H19N2O+ |
| Molecular Weight | 183.27 g/mol |
| Exact Mass | 183.15 |
| IUPAC Name | 1-(2,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrimidin-5-ium-5-yl)propan-2-ol |
| SMILES | CC(O)C[N+]12CCCN=C1CCC2 |
| InChI | InChI=1S/C10H19N2O/c1-9(13)8-12-6-2-4-10(12)11-5-3-7-12/h9,13H,2-8H2,1H3/q+1 |
| InChIKey | KYZKWHHYYFEMSM-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.27 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|