About 2-(2,6-dichlorophenyl)-5-(4-nitrophenyl)-1,3-oxazolidine
2-(2,6-dichlorophenyl)-5-(4-nitrophenyl)-1,3-oxazolidine (PubChem CID 69234335) has the molecular formula C15H12Cl2N2O3
and a molecular weight of 339.18 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)-5-(4-nitrophenyl)-1,3-oxazolidine.
Molecular Properties
| Compound Name | 2-(2,6-dichlorophenyl)-5-(4-nitrophenyl)-1,3-oxazolidine |
| PubChem CID | 69234335 |
| Molecular Formula | C15H12Cl2N2O3 |
| Molecular Weight | 339.18 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | 2-(2,6-dichlorophenyl)-5-(4-nitrophenyl)-1,3-oxazolidine |
| SMILES | O=[N+]([O-])c1ccc(C2CNC(c3c(Cl)cccc3Cl)O2)cc1 |
| InChI | InChI=1S/C15H12Cl2N2O3/c16-11-2-1-3-12(17)14(11)15-18-8-13(22-15)9-4-6-10(7-5-9)19(20)21/h1-7,13,15,18H,8H2 |
| InChIKey | XRAHMHXFWMTIKS-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.18 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,6-dichlorophenyl)-5-(4-nitrophenyl)-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-dichlorophenyl)-5-(4-nitrophenyl)-1,3-oxazolidine?
The IUPAC name of 2-(2,6-dichlorophenyl)-5-(4-nitrophenyl)-1,3-oxazolidine (CID 69234335) is 2-(2,6-dichlorophenyl)-5-(4-nitrophenyl)-1,3-oxazolidine.
What is the SMILES notation for 2-(2,6-dichlorophenyl)-5-(4-nitrophenyl)-1,3-oxazolidine?
The canonical SMILES for 2-(2,6-dichlorophenyl)-5-(4-nitrophenyl)-1,3-oxazolidine is O=[N+]([O-])c1ccc(C2CNC(c3c(Cl)cccc3Cl)O2)cc1.
What is the InChIKey of 2-(2,6-dichlorophenyl)-5-(4-nitrophenyl)-1,3-oxazolidine?
The InChIKey is XRAHMHXFWMTIKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12Cl2N2O3/c16-11-2-1-3-12(17)14(11)15-18-8-13(22-15)9-4-6-10(7-5-9)19(20)21/h1-7,13,15,18H,8H2.
What are the key properties of 2-(2,6-dichlorophenyl)-5-(4-nitrophenyl)-1,3-oxazolidine?
2-(2,6-dichlorophenyl)-5-(4-nitrophenyl)-1,3-oxazolidine has a molecular weight of 339.18 g/mol, XLogP of 4.26, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-dichlorophenyl)-5-(4-nitrophenyl)-1,3-oxazolidine is sourced from PubChem (CID 69234335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).