C30H49NO3Si — CID 69234744
(9E,11S,12S)-8-[tert-butyl(dimethyl)silyl]oxy-1,11-dimethyl-12-[(E)-4-phenylmethoxybut-2-en-2-yl]-1-azacyclododec-9-en-2-one (PubChem CID 69234744) has the molecular formula C30H49NO3Si and a molecular weight of 499.81 g/mol. Its IUPAC name is (9E,11S,12S)-8-[tert-butyl(dimethyl)silyl]oxy-1,11-dimethyl-12-[(E)-4-phenylmethoxybut-2-en-2-yl]-1-azacyclododec-9-en-2-one.
| Compound Name | (9E,11S,12S)-8-[tert-butyl(dimethyl)silyl]oxy-1,11-dimethyl-12-[(E)-4-phenylmethoxybut-2-en-2-yl]-1-azacyclododec-9-en-2-one |
|---|---|
| PubChem CID | 69234744 |
| Molecular Formula | C30H49NO3Si |
| Molecular Weight | 499.81 g/mol |
| Exact Mass | 499.35 |
| IUPAC Name | (9E,11S,12S)-8-[tert-butyl(dimethyl)silyl]oxy-1,11-dimethyl-12-[(E)-4-phenylmethoxybut-2-en-2-yl]-1-azacyclododec-9-en-2-one |
| SMILES | C/C(=C\COCc1ccccc1)[C@@H]1[C@@H](C)/C=C/C(O[Si](C)(C)C(C)(C)C)CCCCCC(=O)N1C |
| InChI | InChI=1S/C30H49NO3Si/c1-24-19-20-27(34-35(7,8)30(3,4)5)17-13-10-14-18-28(32)31(6)29(24)25(2)21-22-33-23-26-15-11-9-12-16-26/h9,11-12,15-16,19-21,24,27,29H,10,13-14,17-18,22-23H2,1-8H3/b20-19+,25-21+/t24-,27?,29-/m0/s1 |
| InChIKey | OCPSOACSQWUHBE-FUSVMKHQSA-N |
| XLogP | 7.52 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.81 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|