About 5-tert-butyl-N-[6-(1,3-thiazol-2-yl)-2-pyridinyl]-1,2-oxazol-3-amine
5-tert-butyl-N-[6-(1,3-thiazol-2-yl)-2-pyridinyl]-1,2-oxazol-3-amine (PubChem CID 69235206) has the molecular formula C15H16N4OS
and a molecular weight of 300.39 g/mol. Its IUPAC name is 5-tert-butyl-N-[6-(1,3-thiazol-2-yl)-2-pyridinyl]-1,2-oxazol-3-amine.
Molecular Properties
| Compound Name | 5-tert-butyl-N-[6-(1,3-thiazol-2-yl)-2-pyridinyl]-1,2-oxazol-3-amine |
| PubChem CID | 69235206 |
| Molecular Formula | C15H16N4OS |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 5-tert-butyl-N-[6-(1,3-thiazol-2-yl)-2-pyridinyl]-1,2-oxazol-3-amine |
| SMILES | CC(C)(C)c1cc(Nc2cccc(-c3nccs3)n2)no1 |
| InChI | InChI=1S/C15H16N4OS/c1-15(2,3)11-9-13(19-20-11)18-12-6-4-5-10(17-12)14-16-7-8-21-14/h4-9H,1-3H3,(H,17,18,19) |
| InChIKey | RSBMBTYMEFZPCR-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-tert-butyl-N-[6-(1,3-thiazol-2-yl)-2-pyridinyl]-1,2-oxazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-N-[6-(1,3-thiazol-2-yl)-2-pyridinyl]-1,2-oxazol-3-amine?
The IUPAC name of 5-tert-butyl-N-[6-(1,3-thiazol-2-yl)-2-pyridinyl]-1,2-oxazol-3-amine (CID 69235206) is 5-tert-butyl-N-[6-(1,3-thiazol-2-yl)-2-pyridinyl]-1,2-oxazol-3-amine.
What is the SMILES notation for 5-tert-butyl-N-[6-(1,3-thiazol-2-yl)-2-pyridinyl]-1,2-oxazol-3-amine?
The canonical SMILES for 5-tert-butyl-N-[6-(1,3-thiazol-2-yl)-2-pyridinyl]-1,2-oxazol-3-amine is CC(C)(C)c1cc(Nc2cccc(-c3nccs3)n2)no1.
What is the InChIKey of 5-tert-butyl-N-[6-(1,3-thiazol-2-yl)-2-pyridinyl]-1,2-oxazol-3-amine?
The InChIKey is RSBMBTYMEFZPCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N4OS/c1-15(2,3)11-9-13(19-20-11)18-12-6-4-5-10(17-12)14-16-7-8-21-14/h4-9H,1-3H3,(H,17,18,19).
What are the key properties of 5-tert-butyl-N-[6-(1,3-thiazol-2-yl)-2-pyridinyl]-1,2-oxazol-3-amine?
5-tert-butyl-N-[6-(1,3-thiazol-2-yl)-2-pyridinyl]-1,2-oxazol-3-amine has a molecular weight of 300.39 g/mol, XLogP of 4.23, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-N-[6-(1,3-thiazol-2-yl)-2-pyridinyl]-1,2-oxazol-3-amine is sourced from PubChem (CID 69235206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).