C13H15ClN2 — CID 69235228
(6-chloro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)methanamine (PubChem CID 69235228) has the molecular formula C13H15ClN2 and a molecular weight of 234.73 g/mol. Its IUPAC name is (6-chloro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)methanamine.
| Compound Name | (6-chloro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)methanamine |
|---|---|
| PubChem CID | 69235228 |
| Molecular Formula | C13H15ClN2 |
| Molecular Weight | 234.73 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | (6-chloro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)methanamine |
| SMILES | NCC1CCc2[nH]c3ccc(Cl)cc3c2C1 |
| InChI | InChI=1S/C13H15ClN2/c14-9-2-4-13-11(6-9)10-5-8(7-15)1-3-12(10)16-13/h2,4,6,8,16H,1,3,5,7,15H2 |
| InChIKey | MIYDPFGXKQWIAC-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.73 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|