C16H34N2+2 — CID 69235681
2,2-diethyl-1,4-dipropyl-1,4-diazoniabicyclo[2.2.2]octane (PubChem CID 69235681) has the molecular formula C16H34N2+2 and a molecular weight of 254.46 g/mol. Its IUPAC name is 2,2-diethyl-1,4-dipropyl-1,4-diazoniabicyclo[2.2.2]octane.
| Compound Name | 2,2-diethyl-1,4-dipropyl-1,4-diazoniabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 69235681 |
| Molecular Formula | C16H34N2+2 |
| Molecular Weight | 254.46 g/mol |
| Exact Mass | 254.27 |
| IUPAC Name | 2,2-diethyl-1,4-dipropyl-1,4-diazoniabicyclo[2.2.2]octane |
| SMILES | CCC[N+]12CC[N+](CCC)(CC1)C(CC)(CC)C2 |
| InChI | InChI=1S/C16H34N2/c1-5-9-17-11-13-18(10-6-2,14-12-17)16(7-3,8-4)15-17/h5-15H2,1-4H3/q+2 |
| InChIKey | SPFVEWIYNNFFQB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.46 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|