C21H26F4NOS2+ — CID 69235971
1,1-bis[5-(difluoromethyl)thiophen-2-yl]-2-[(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl]ethanol (PubChem CID 69235971) has the molecular formula C21H26F4NOS2+ and a molecular weight of 448.57 g/mol. Its IUPAC name is 1,1-bis[5-(difluoromethyl)thiophen-2-yl]-2-[(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl]ethanol.
| Compound Name | 1,1-bis[5-(difluoromethyl)thiophen-2-yl]-2-[(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl]ethanol |
|---|---|
| PubChem CID | 69235971 |
| Molecular Formula | C21H26F4NOS2+ |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | 1,1-bis[5-(difluoromethyl)thiophen-2-yl]-2-[(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl]ethanol |
| SMILES | C[N+]1(C)[C@@H]2CC[C@H]1CC(CC(O)(c1ccc(C(F)F)s1)c1ccc(C(F)F)s1)C2 |
| InChI | InChI=1S/C21H26F4NOS2/c1-26(2)13-3-4-14(26)10-12(9-13)11-21(27,17-7-5-15(28-17)19(22)23)18-8-6-16(29-18)20(24)25/h5-8,12-14,19-20,27H,3-4,9-11H2,1-2H3/q+1/t12?,13-,14+ |
| InChIKey | JVEAZFJZTPGMLB-AGUYFDCRSA-N |
| XLogP | 6.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|