C18H28N4O — CID 69236150
7,8-dipentyl-5-prop-2-enyl-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one (PubChem CID 69236150) has the molecular formula C18H28N4O and a molecular weight of 316.45 g/mol. Its IUPAC name is 7,8-dipentyl-5-prop-2-enyl-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one.
| Compound Name | 7,8-dipentyl-5-prop-2-enyl-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one |
|---|---|
| PubChem CID | 69236150 |
| Molecular Formula | C18H28N4O |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.23 |
| IUPAC Name | 7,8-dipentyl-5-prop-2-enyl-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one |
| SMILES | C=CCc1nc(CCCCC)c(CCCCC)c2n[nH]c(=O)n12 |
| InChI | InChI=1S/C18H28N4O/c1-4-7-9-12-14-15(13-10-8-5-2)19-16(11-6-3)22-17(14)20-21-18(22)23/h6H,3-5,7-13H2,1-2H3,(H,21,23) |
| InChIKey | JWTDJWHYSVMXBI-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|