C21H30NOS2+ — CID 69236307
2-[(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl]-1,1-bis(3-methylthiophen-2-yl)ethanol (PubChem CID 69236307) has the molecular formula C21H30NOS2+ and a molecular weight of 376.61 g/mol. Its IUPAC name is 2-[(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl]-1,1-bis(3-methylthiophen-2-yl)ethanol.
| Compound Name | 2-[(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl]-1,1-bis(3-methylthiophen-2-yl)ethanol |
|---|---|
| PubChem CID | 69236307 |
| Molecular Formula | C21H30NOS2+ |
| Molecular Weight | 376.61 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 2-[(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl]-1,1-bis(3-methylthiophen-2-yl)ethanol |
| SMILES | Cc1ccsc1C(O)(CC1C[C@H]2CC[C@@H](C1)[N+]2(C)C)c1sccc1C |
| InChI | InChI=1S/C21H30NOS2/c1-14-7-9-24-19(14)21(23,20-15(2)8-10-25-20)13-16-11-17-5-6-18(12-16)22(17,3)4/h7-10,16-18,23H,5-6,11-13H2,1-4H3/q+1/t16?,17-,18+ |
| InChIKey | XRAXFSGUEZFONI-AYHJJNSGSA-N |
| XLogP | 5.07 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.61 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|