C12H11NO — CID 69236363
3,4,4a,9-tetrahydrocarbazol-2-one (PubChem CID 69236363) has the molecular formula C12H11NO and a molecular weight of 185.23 g/mol. Its IUPAC name is 3,4,4a,9-tetrahydrocarbazol-2-one.
| Compound Name | 3,4,4a,9-tetrahydrocarbazol-2-one |
|---|---|
| PubChem CID | 69236363 |
| Molecular Formula | C12H11NO |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | 3,4,4a,9-tetrahydrocarbazol-2-one |
| SMILES | O=C1C=C2Nc3ccccc3C2CC1 |
| InChI | InChI=1S/C12H11NO/c14-8-5-6-10-9-3-1-2-4-11(9)13-12(10)7-8/h1-4,7,10,13H,5-6H2 |
| InChIKey | SRLXYXCLXKOFMA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |