About ethyl 2-(6,7-dimethoxyspiro[4H-isoquinoline-3,1'-cyclohexane]-1-yl)acetate
ethyl 2-(6,7-dimethoxyspiro[4H-isoquinoline-3,1'-cyclohexane]-1-yl)acetate (PubChem CID 6923655) has the molecular formula C20H27NO4
and a molecular weight of 345.44 g/mol. Its IUPAC name is ethyl 2-(6,7-dimethoxyspiro[4H-isoquinoline-3,1'-cyclohexane]-1-yl)acetate.
Molecular Properties
| Compound Name | ethyl 2-(6,7-dimethoxyspiro[4H-isoquinoline-3,1'-cyclohexane]-1-yl)acetate |
| PubChem CID | 6923655 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | ethyl 2-(6,7-dimethoxyspiro[4H-isoquinoline-3,1'-cyclohexane]-1-yl)acetate |
| SMILES | CCOC(=O)CC1=NC2(CCCCC2)Cc2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C20H27NO4/c1-4-25-19(22)12-16-15-11-18(24-3)17(23-2)10-14(15)13-20(21-16)8-6-5-7-9-20/h10-11H,4-9,12-13H2,1-3H3 |
| InChIKey | URMRWSIYXZAOAN-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-(6,7-dimethoxyspiro[4H-isoquinoline-3,1'-cyclohexane]-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(6,7-dimethoxyspiro[4H-isoquinoline-3,1'-cyclohexane]-1-yl)acetate?
The IUPAC name of ethyl 2-(6,7-dimethoxyspiro[4H-isoquinoline-3,1'-cyclohexane]-1-yl)acetate (CID 6923655) is ethyl 2-(6,7-dimethoxyspiro[4H-isoquinoline-3,1'-cyclohexane]-1-yl)acetate.
What is the SMILES notation for ethyl 2-(6,7-dimethoxyspiro[4H-isoquinoline-3,1'-cyclohexane]-1-yl)acetate?
The canonical SMILES for ethyl 2-(6,7-dimethoxyspiro[4H-isoquinoline-3,1'-cyclohexane]-1-yl)acetate is CCOC(=O)CC1=NC2(CCCCC2)Cc2cc(OC)c(OC)cc21.
What is the InChIKey of ethyl 2-(6,7-dimethoxyspiro[4H-isoquinoline-3,1'-cyclohexane]-1-yl)acetate?
The InChIKey is URMRWSIYXZAOAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27NO4/c1-4-25-19(22)12-16-15-11-18(24-3)17(23-2)10-14(15)13-20(21-16)8-6-5-7-9-20/h10-11H,4-9,12-13H2,1-3H3.
What are the key properties of ethyl 2-(6,7-dimethoxyspiro[4H-isoquinoline-3,1'-cyclohexane]-1-yl)acetate?
ethyl 2-(6,7-dimethoxyspiro[4H-isoquinoline-3,1'-cyclohexane]-1-yl)acetate has a molecular weight of 345.44 g/mol, XLogP of 3.71, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(6,7-dimethoxyspiro[4H-isoquinoline-3,1'-cyclohexane]-1-yl)acetate is sourced from PubChem (CID 6923655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).