C10H23N2O2+ — CID 69236774
1,1-bis(ethoxymethyl)piperazin-1-ium (PubChem CID 69236774) has the molecular formula C10H23N2O2+ and a molecular weight of 203.31 g/mol. Its IUPAC name is 1,1-bis(ethoxymethyl)piperazin-1-ium.
| Compound Name | 1,1-bis(ethoxymethyl)piperazin-1-ium |
|---|---|
| PubChem CID | 69236774 |
| Molecular Formula | C10H23N2O2+ |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.18 |
| IUPAC Name | 1,1-bis(ethoxymethyl)piperazin-1-ium |
| SMILES | CCOC[N+]1(COCC)CCNCC1 |
| InChI | InChI=1S/C10H23N2O2/c1-3-13-9-12(10-14-4-2)7-5-11-6-8-12/h11H,3-10H2,1-2H3/q+1 |
| InChIKey | CICPNXUYFYKCRB-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|