About (4S)-4-(chloromethyl)-2,2-dimethyl-3,4-dihydro-1H-benzo[f]isoquinolin-3-ium
(4S)-4-(chloromethyl)-2,2-dimethyl-3,4-dihydro-1H-benzo[f]isoquinolin-3-ium (PubChem CID 6923705) has the molecular formula C16H19ClN+
and a molecular weight of 260.79 g/mol. Its IUPAC name is (4S)-4-(chloromethyl)-2,2-dimethyl-3,4-dihydro-1H-benzo[f]isoquinolin-3-ium.
Molecular Properties
| Compound Name | (4S)-4-(chloromethyl)-2,2-dimethyl-3,4-dihydro-1H-benzo[f]isoquinolin-3-ium |
| PubChem CID | 6923705 |
| Molecular Formula | C16H19ClN+ |
| Molecular Weight | 260.79 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | (4S)-4-(chloromethyl)-2,2-dimethyl-3,4-dihydro-1H-benzo[f]isoquinolin-3-ium |
| SMILES | CC1(C)Cc2c(ccc3ccccc23)[C@@H](CCl)[NH2+]1 |
| InChI | InChI=1S/C16H18ClN/c1-16(2)9-14-12-6-4-3-5-11(12)7-8-13(14)15(10-17)18-16/h3-8,15,18H,9-10H2,1-2H3/p+1/t15-/m1/s1 |
| InChIKey | BWCZXBBFZYYUIZ-OAHLLOKOSA-O |
| XLogP | 3.02 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.79 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (4S)-4-(chloromethyl)-2,2-dimethyl-3,4-dihydro-1H-benzo[f]isoquinolin-3-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-(chloromethyl)-2,2-dimethyl-3,4-dihydro-1H-benzo[f]isoquinolin-3-ium?
The IUPAC name of (4S)-4-(chloromethyl)-2,2-dimethyl-3,4-dihydro-1H-benzo[f]isoquinolin-3-ium (CID 6923705) is (4S)-4-(chloromethyl)-2,2-dimethyl-3,4-dihydro-1H-benzo[f]isoquinolin-3-ium.
What is the SMILES notation for (4S)-4-(chloromethyl)-2,2-dimethyl-3,4-dihydro-1H-benzo[f]isoquinolin-3-ium?
The canonical SMILES for (4S)-4-(chloromethyl)-2,2-dimethyl-3,4-dihydro-1H-benzo[f]isoquinolin-3-ium is CC1(C)Cc2c(ccc3ccccc23)[C@@H](CCl)[NH2+]1.
What is the InChIKey of (4S)-4-(chloromethyl)-2,2-dimethyl-3,4-dihydro-1H-benzo[f]isoquinolin-3-ium?
The InChIKey is BWCZXBBFZYYUIZ-OAHLLOKOSA-O. The full InChI is InChI=1S/C16H18ClN/c1-16(2)9-14-12-6-4-3-5-11(12)7-8-13(14)15(10-17)18-16/h3-8,15,18H,9-10H2,1-2H3/p+1/t15-/m1/s1.
What are the key properties of (4S)-4-(chloromethyl)-2,2-dimethyl-3,4-dihydro-1H-benzo[f]isoquinolin-3-ium?
(4S)-4-(chloromethyl)-2,2-dimethyl-3,4-dihydro-1H-benzo[f]isoquinolin-3-ium has a molecular weight of 260.79 g/mol, XLogP of 3.02, 1 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-(chloromethyl)-2,2-dimethyl-3,4-dihydro-1H-benzo[f]isoquinolin-3-ium is sourced from PubChem (CID 6923705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).