C19H23BrClNO2S — CID 69237786
3-[[2-[(5-bromo-2-methoxyphenyl)methylsulfanyl]phenyl]methoxy]pyrrolidine;hydrochloride (PubChem CID 69237786) has the molecular formula C19H23BrClNO2S and a molecular weight of 444.82 g/mol. Its IUPAC name is 3-[[2-[(5-bromo-2-methoxyphenyl)methylsulfanyl]phenyl]methoxy]pyrrolidine;hydrochloride.
| Compound Name | 3-[[2-[(5-bromo-2-methoxyphenyl)methylsulfanyl]phenyl]methoxy]pyrrolidine;hydrochloride |
|---|---|
| PubChem CID | 69237786 |
| Molecular Formula | C19H23BrClNO2S |
| Molecular Weight | 444.82 g/mol |
| Exact Mass | 443.03 |
| IUPAC Name | 3-[[2-[(5-bromo-2-methoxyphenyl)methylsulfanyl]phenyl]methoxy]pyrrolidine;hydrochloride |
| SMILES | COc1ccc(Br)cc1CSc1ccccc1COC1CCNC1.Cl |
| InChI | InChI=1S/C19H22BrNO2S.ClH/c1-22-18-7-6-16(20)10-15(18)13-24-19-5-3-2-4-14(19)12-23-17-8-9-21-11-17;/h2-7,10,17,21H,8-9,11-13H2,1H3;1H |
| InChIKey | QMGNWBFBKUNGKK-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.82 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |