C24H29Cl2N3O — CID 69237846
(2R)-2-amino-1-[5-[cyclohexyl(methyl)amino]-1,3-dihydroisoindol-2-yl]-3-(2,4-dichlorophenyl)propan-1-one (PubChem CID 69237846) has the molecular formula C24H29Cl2N3O and a molecular weight of 446.42 g/mol. Its IUPAC name is (2R)-2-amino-1-[5-[cyclohexyl(methyl)amino]-1,3-dihydroisoindol-2-yl]-3-(2,4-dichlorophenyl)propan-1-one.
| Compound Name | (2R)-2-amino-1-[5-[cyclohexyl(methyl)amino]-1,3-dihydroisoindol-2-yl]-3-(2,4-dichlorophenyl)propan-1-one |
|---|---|
| PubChem CID | 69237846 |
| Molecular Formula | C24H29Cl2N3O |
| Molecular Weight | 446.42 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | (2R)-2-amino-1-[5-[cyclohexyl(methyl)amino]-1,3-dihydroisoindol-2-yl]-3-(2,4-dichlorophenyl)propan-1-one |
| SMILES | CN(c1ccc2c(c1)CN(C(=O)[C@H](N)Cc1ccc(Cl)cc1Cl)C2)C1CCCCC1 |
| InChI | InChI=1S/C24H29Cl2N3O/c1-28(20-5-3-2-4-6-20)21-10-8-17-14-29(15-18(17)11-21)24(30)23(27)12-16-7-9-19(25)13-22(16)26/h7-11,13,20,23H,2-6,12,14-15,27H2,1H3/t23-/m1/s1 |
| InChIKey | LECVIRZGJMFXTR-HSZRJFAPSA-N |
| XLogP | 5.17 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.42 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|