C31H35Cl2F2N9O6 — CID 69238319
(2,4-difluorophenyl)methyl N-[1,3-bis(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)propyl]carbamate (PubChem CID 69238319) has the molecular formula C31H35Cl2F2N9O6 and a molecular weight of 738.58 g/mol. Its IUPAC name is (2,4-difluorophenyl)methyl N-[1,3-bis(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)propyl]carbamate.
| Compound Name | (2,4-difluorophenyl)methyl N-[1,3-bis(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)propyl]carbamate |
|---|---|
| PubChem CID | 69238319 |
| Molecular Formula | C31H35Cl2F2N9O6 |
| Molecular Weight | 738.58 g/mol |
| Exact Mass | 737.21 |
| IUPAC Name | (2,4-difluorophenyl)methyl N-[1,3-bis(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)propyl]carbamate |
| SMILES | CCCCCn1c(=O)n(CCC(NC(=O)OCc2ccc(F)cc2F)n2c(=O)c3[nH]c(Cl)nc3n(CCCCC)c2=O)c(=O)c2[nH]c(Cl)nc21 |
| InChI | InChI=1S/C31H35Cl2F2N9O6/c1-3-5-7-12-41-23-21(37-27(32)39-23)25(45)43(30(41)48)14-11-20(36-29(47)50-16-17-9-10-18(34)15-19(17)35)44-26(46)22-24(40-28(33)38-22)42(31(44)49)13-8-6-4-2/h9-10,15,20H,3-8,11-14,16H2,1-2H3,(H,36,47)(H,37,39)(H,38,40) |
| InChIKey | GUZJSSRCEAECTQ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 183.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.58 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|