About 1-(1-prop-2-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethanamine
1-(1-prop-2-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethanamine (PubChem CID 69238784) has the molecular formula C8H16N3+
and a molecular weight of 154.24 g/mol. Its IUPAC name is 1-(1-prop-2-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethanamine.
Molecular Properties
| Compound Name | 1-(1-prop-2-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethanamine |
| PubChem CID | 69238784 |
| Molecular Formula | C8H16N3+ |
| Molecular Weight | 154.24 g/mol |
| Exact Mass | 154.13 |
| IUPAC Name | 1-(1-prop-2-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethanamine |
| SMILES | C=CC[N+]1(C(C)N)C=NCC1 |
| InChI | InChI=1S/C8H16N3/c1-3-5-11(8(2)9)6-4-10-7-11/h3,7-8H,1,4-6,9H2,2H3/q+1 |
| InChIKey | ZBMIMGCEVAYBKG-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.24 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-prop-2-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-prop-2-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethanamine?
The IUPAC name of 1-(1-prop-2-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethanamine (CID 69238784) is 1-(1-prop-2-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethanamine.
What is the SMILES notation for 1-(1-prop-2-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethanamine?
The canonical SMILES for 1-(1-prop-2-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethanamine is C=CC[N+]1(C(C)N)C=NCC1.
What is the InChIKey of 1-(1-prop-2-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethanamine?
The InChIKey is ZBMIMGCEVAYBKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N3/c1-3-5-11(8(2)9)6-4-10-7-11/h3,7-8H,1,4-6,9H2,2H3/q+1.
What are the key properties of 1-(1-prop-2-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethanamine?
1-(1-prop-2-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethanamine has a molecular weight of 154.24 g/mol, XLogP of 0.34, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-prop-2-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethanamine is sourced from PubChem (CID 69238784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).