About 3-(4,5-dihydroimidazol-1-yl)pent-4-en-2-amine
3-(4,5-dihydroimidazol-1-yl)pent-4-en-2-amine (PubChem CID 69238786) has the molecular formula C8H15N3
and a molecular weight of 153.23 g/mol. Its IUPAC name is 3-(4,5-dihydroimidazol-1-yl)pent-4-en-2-amine.
Molecular Properties
| Compound Name | 3-(4,5-dihydroimidazol-1-yl)pent-4-en-2-amine |
| PubChem CID | 69238786 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | 3-(4,5-dihydroimidazol-1-yl)pent-4-en-2-amine |
| SMILES | C=CC(C(C)N)N1C=NCC1 |
| InChI | InChI=1S/C8H15N3/c1-3-8(7(2)9)11-5-4-10-6-11/h3,6-8H,1,4-5,9H2,2H3 |
| InChIKey | PHCSIPJPMTWLAE-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(4,5-dihydroimidazol-1-yl)pent-4-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4,5-dihydroimidazol-1-yl)pent-4-en-2-amine?
The IUPAC name of 3-(4,5-dihydroimidazol-1-yl)pent-4-en-2-amine (CID 69238786) is 3-(4,5-dihydroimidazol-1-yl)pent-4-en-2-amine.
What is the SMILES notation for 3-(4,5-dihydroimidazol-1-yl)pent-4-en-2-amine?
The canonical SMILES for 3-(4,5-dihydroimidazol-1-yl)pent-4-en-2-amine is C=CC(C(C)N)N1C=NCC1.
What is the InChIKey of 3-(4,5-dihydroimidazol-1-yl)pent-4-en-2-amine?
The InChIKey is PHCSIPJPMTWLAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3/c1-3-8(7(2)9)11-5-4-10-6-11/h3,6-8H,1,4-5,9H2,2H3.
What are the key properties of 3-(4,5-dihydroimidazol-1-yl)pent-4-en-2-amine?
3-(4,5-dihydroimidazol-1-yl)pent-4-en-2-amine has a molecular weight of 153.23 g/mol, XLogP of 0.23, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,5-dihydroimidazol-1-yl)pent-4-en-2-amine is sourced from PubChem (CID 69238786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).