C8H15N3 — CID 69238787
1-(1-prop-2-enyl-4,5-dihydroimidazol-2-yl)ethanamine (PubChem CID 69238787) has the molecular formula C8H15N3 and a molecular weight of 153.23 g/mol. Its IUPAC name is 1-(1-prop-2-enyl-4,5-dihydroimidazol-2-yl)ethanamine.
| Compound Name | 1-(1-prop-2-enyl-4,5-dihydroimidazol-2-yl)ethanamine |
|---|---|
| PubChem CID | 69238787 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | 1-(1-prop-2-enyl-4,5-dihydroimidazol-2-yl)ethanamine |
| SMILES | C=CCN1CCN=C1C(C)N |
| InChI | InChI=1S/C8H15N3/c1-3-5-11-6-4-10-8(11)7(2)9/h3,7H,1,4-6,9H2,2H3 |
| InChIKey | HEHAUVBWGFOCRN-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|