C20H23F3N2O — CID 69239676
(2S,3S)-2-phenyl-3-[[2-(2,2,2-trifluoroethoxy)phenyl]methyl]piperidin-1-amine (PubChem CID 69239676) has the molecular formula C20H23F3N2O and a molecular weight of 364.41 g/mol. Its IUPAC name is (2S,3S)-2-phenyl-3-[[2-(2,2,2-trifluoroethoxy)phenyl]methyl]piperidin-1-amine.
| Compound Name | (2S,3S)-2-phenyl-3-[[2-(2,2,2-trifluoroethoxy)phenyl]methyl]piperidin-1-amine |
|---|---|
| PubChem CID | 69239676 |
| Molecular Formula | C20H23F3N2O |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | (2S,3S)-2-phenyl-3-[[2-(2,2,2-trifluoroethoxy)phenyl]methyl]piperidin-1-amine |
| SMILES | NN1CCC[C@@H](Cc2ccccc2OCC(F)(F)F)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C20H23F3N2O/c21-20(22,23)14-26-18-11-5-4-9-16(18)13-17-10-6-12-25(24)19(17)15-7-2-1-3-8-15/h1-5,7-9,11,17,19H,6,10,12-14,24H2/t17-,19+/m0/s1 |
| InChIKey | ZLWDGHYWWGZMJZ-PKOBYXMFSA-N |
| XLogP | 4.50 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|