C33H41F3N2O6 — CID 69240350
(2S)-2-[benzyl-[[(1S,3R)-3-[[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]methoxy]cyclohexyl]methyl]amino]-3-methylbutanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 69240350) has the molecular formula C33H41F3N2O6 and a molecular weight of 618.69 g/mol. Its IUPAC name is (2S)-2-[benzyl-[[(1S,3R)-3-[[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]methoxy]cyclohexyl]methyl]amino]-3-methylbutanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | (2S)-2-[benzyl-[[(1S,3R)-3-[[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]methoxy]cyclohexyl]methyl]amino]-3-methylbutanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 69240350 |
| Molecular Formula | C33H41F3N2O6 |
| Molecular Weight | 618.69 g/mol |
| Exact Mass | 618.29 |
| IUPAC Name | (2S)-2-[benzyl-[[(1S,3R)-3-[[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]methoxy]cyclohexyl]methyl]amino]-3-methylbutanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccc(-c2nc(CO[C@@H]3CCC[C@H](CN(Cc4ccccc4)[C@H](C(=O)O)C(C)C)C3)c(C)o2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C31H40N2O4.C2HF3O2/c1-21(2)29(31(34)35)33(18-24-9-6-5-7-10-24)19-25-11-8-12-27(17-25)36-20-28-23(4)37-30(32-28)26-15-13-22(3)14-16-26;3-2(4,5)1(6)7/h5-7,9-10,13-16,21,25,27,29H,8,11-12,17-20H2,1-4H3,(H,34,35);(H,6,7)/t25-,27+,29-;/m0./s1 |
| InChIKey | HRHRSBDIFRKGPC-UNXORJANSA-N |
| XLogP | 7.28 |
| TPSA | 113.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.69 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |