C23H29ClN6O2 — CID 69241048
1-(3-chloropyrazolo[1,5-a]pyridin-2-yl)-1-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]urea (PubChem CID 69241048) has the molecular formula C23H29ClN6O2 and a molecular weight of 456.98 g/mol. Its IUPAC name is 1-(3-chloropyrazolo[1,5-a]pyridin-2-yl)-1-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]urea.
| Compound Name | 1-(3-chloropyrazolo[1,5-a]pyridin-2-yl)-1-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]urea |
|---|---|
| PubChem CID | 69241048 |
| Molecular Formula | C23H29ClN6O2 |
| Molecular Weight | 456.98 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | 1-(3-chloropyrazolo[1,5-a]pyridin-2-yl)-1-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]urea |
| SMILES | COc1ccccc1N1CCN(CCCCN(C(N)=O)c2nn3ccccc3c2Cl)CC1 |
| InChI | InChI=1S/C23H29ClN6O2/c1-32-20-10-3-2-8-18(20)28-16-14-27(15-17-28)11-6-7-12-29(23(25)31)22-21(24)19-9-4-5-13-30(19)26-22/h2-5,8-10,13H,6-7,11-12,14-17H2,1H3,(H2,25,31) |
| InChIKey | QMKOHVLYBKLVMK-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 79.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.98 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|