C13H15F3N2O3S2 — CID 69241052
N-[2-[(5,5-dimethyl-2-oxo-1,3-thiazolidin-3-yl)methyl]phenyl]-1,1,1-trifluoromethanesulfonamide (PubChem CID 69241052) has the molecular formula C13H15F3N2O3S2 and a molecular weight of 368.40 g/mol. Its IUPAC name is N-[2-[(5,5-dimethyl-2-oxo-1,3-thiazolidin-3-yl)methyl]phenyl]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[2-[(5,5-dimethyl-2-oxo-1,3-thiazolidin-3-yl)methyl]phenyl]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 69241052 |
| Molecular Formula | C13H15F3N2O3S2 |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | N-[2-[(5,5-dimethyl-2-oxo-1,3-thiazolidin-3-yl)methyl]phenyl]-1,1,1-trifluoromethanesulfonamide |
| SMILES | CC1(C)CN(Cc2ccccc2NS(=O)(=O)C(F)(F)F)C(=O)S1 |
| InChI | InChI=1S/C13H15F3N2O3S2/c1-12(2)8-18(11(19)22-12)7-9-5-3-4-6-10(9)17-23(20,21)13(14,15)16/h3-6,17H,7-8H2,1-2H3 |
| InChIKey | RULRFPYYBJRJIN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|