C16H21NO3 — CID 69241169
(4aR,10bS)-4-propyl-2,3,4a,5,6,10b-hexahydrobenzo[h][1,4]benzoxazine-9-carboxylic acid (PubChem CID 69241169) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is (4aR,10bS)-4-propyl-2,3,4a,5,6,10b-hexahydrobenzo[h][1,4]benzoxazine-9-carboxylic acid.
| Compound Name | (4aR,10bS)-4-propyl-2,3,4a,5,6,10b-hexahydrobenzo[h][1,4]benzoxazine-9-carboxylic acid |
|---|---|
| PubChem CID | 69241169 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | (4aR,10bS)-4-propyl-2,3,4a,5,6,10b-hexahydrobenzo[h][1,4]benzoxazine-9-carboxylic acid |
| SMILES | CCCN1CCO[C@H]2c3cc(C(=O)O)ccc3CC[C@H]21 |
| InChI | InChI=1S/C16H21NO3/c1-2-7-17-8-9-20-15-13-10-12(16(18)19)4-3-11(13)5-6-14(15)17/h3-4,10,14-15H,2,5-9H2,1H3,(H,18,19)/t14-,15+/m1/s1 |
| InChIKey | ZWCUBCGFLWXFOM-CABCVRRESA-N |
| XLogP | 2.48 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |