C36H53NO2 — CID 69241525
3,5-bis[3-(4-tert-butylphenyl)butyl]-7a-prop-2-enyl-1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazole (PubChem CID 69241525) has the molecular formula C36H53NO2 and a molecular weight of 531.83 g/mol. Its IUPAC name is 3,5-bis[3-(4-tert-butylphenyl)butyl]-7a-prop-2-enyl-1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazole.
| Compound Name | 3,5-bis[3-(4-tert-butylphenyl)butyl]-7a-prop-2-enyl-1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazole |
|---|---|
| PubChem CID | 69241525 |
| Molecular Formula | C36H53NO2 |
| Molecular Weight | 531.83 g/mol |
| Exact Mass | 531.41 |
| IUPAC Name | 3,5-bis[3-(4-tert-butylphenyl)butyl]-7a-prop-2-enyl-1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazole |
| SMILES | C=CCC12COC(CCC(C)c3ccc(C(C)(C)C)cc3)N1C(CCC(C)c1ccc(C(C)(C)C)cc1)OC2 |
| InChI | InChI=1S/C36H53NO2/c1-10-23-36-24-38-32(21-11-26(2)28-13-17-30(18-14-28)34(4,5)6)37(36)33(39-25-36)22-12-27(3)29-15-19-31(20-16-29)35(7,8)9/h10,13-20,26-27,32-33H,1,11-12,21-25H2,2-9H3 |
| InChIKey | QORTXJHNHVOSSH-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.83 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|