About [2-(2-hydroxypropan-2-yl)cyclopentyl]-(5-iodo-1,3-thiazol-2-yl)methanone
[2-(2-hydroxypropan-2-yl)cyclopentyl]-(5-iodo-1,3-thiazol-2-yl)methanone (PubChem CID 69243341) has the molecular formula C12H16INO2S
and a molecular weight of 365.24 g/mol. Its IUPAC name is [2-(2-hydroxypropan-2-yl)cyclopentyl]-(5-iodo-1,3-thiazol-2-yl)methanone.
Molecular Properties
| Compound Name | [2-(2-hydroxypropan-2-yl)cyclopentyl]-(5-iodo-1,3-thiazol-2-yl)methanone |
| PubChem CID | 69243341 |
| Molecular Formula | C12H16INO2S |
| Molecular Weight | 365.24 g/mol |
| Exact Mass | 364.99 |
| IUPAC Name | [2-(2-hydroxypropan-2-yl)cyclopentyl]-(5-iodo-1,3-thiazol-2-yl)methanone |
| SMILES | CC(C)(O)C1CCCC1C(=O)c1ncc(I)s1 |
| InChI | InChI=1S/C12H16INO2S/c1-12(2,16)8-5-3-4-7(8)10(15)11-14-6-9(13)17-11/h6-8,16H,3-5H2,1-2H3 |
| InChIKey | BKQGUBHODNLZHL-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.24 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [2-(2-hydroxypropan-2-yl)cyclopentyl]-(5-iodo-1,3-thiazol-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-hydroxypropan-2-yl)cyclopentyl]-(5-iodo-1,3-thiazol-2-yl)methanone?
The IUPAC name of [2-(2-hydroxypropan-2-yl)cyclopentyl]-(5-iodo-1,3-thiazol-2-yl)methanone (CID 69243341) is [2-(2-hydroxypropan-2-yl)cyclopentyl]-(5-iodo-1,3-thiazol-2-yl)methanone.
What is the SMILES notation for [2-(2-hydroxypropan-2-yl)cyclopentyl]-(5-iodo-1,3-thiazol-2-yl)methanone?
The canonical SMILES for [2-(2-hydroxypropan-2-yl)cyclopentyl]-(5-iodo-1,3-thiazol-2-yl)methanone is CC(C)(O)C1CCCC1C(=O)c1ncc(I)s1.
What is the InChIKey of [2-(2-hydroxypropan-2-yl)cyclopentyl]-(5-iodo-1,3-thiazol-2-yl)methanone?
The InChIKey is BKQGUBHODNLZHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16INO2S/c1-12(2,16)8-5-3-4-7(8)10(15)11-14-6-9(13)17-11/h6-8,16H,3-5H2,1-2H3.
What are the key properties of [2-(2-hydroxypropan-2-yl)cyclopentyl]-(5-iodo-1,3-thiazol-2-yl)methanone?
[2-(2-hydroxypropan-2-yl)cyclopentyl]-(5-iodo-1,3-thiazol-2-yl)methanone has a molecular weight of 365.24 g/mol, XLogP of 3.12, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-hydroxypropan-2-yl)cyclopentyl]-(5-iodo-1,3-thiazol-2-yl)methanone is sourced from PubChem (CID 69243341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).